C14H15NO3S — CID 43164522
4-[(2-methylphenyl)methoxy]benzenesulfonamide (PubChem CID 43164522) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-[(2-methylphenyl)methoxy]benzenesulfonamide.
| Compound Name | 4-[(2-methylphenyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 43164522 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-[(2-methylphenyl)methoxy]benzenesulfonamide |
| SMILES | Cc1ccccc1COc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H15NO3S/c1-11-4-2-3-5-12(11)10-18-13-6-8-14(9-7-13)19(15,16)17/h2-9H,10H2,1H3,(H2,15,16,17) |
| InChIKey | CANWVODDWGXZFT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |