C17H17ClN2O5S — CID 7993898
[(2R)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 7993898) has the molecular formula C17H17ClN2O5S and a molecular weight of 396.85 g/mol. Its IUPAC name is [(2R)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(2R)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7993898 |
| Molecular Formula | C17H17ClN2O5S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | [(2R)-1-(benzylamino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(S(N)(=O)=O)ccc1Cl)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O5S/c1-11(16(21)20-10-12-5-3-2-4-6-12)25-17(22)14-9-13(26(19,23)24)7-8-15(14)18/h2-9,11H,10H2,1H3,(H,20,21)(H2,19,23,24)/t11-/m1/s1 |
| InChIKey | TYGPRSGIONRVDY-LLVKDONJSA-N |
| XLogP | 1.85 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |