C17H18ClNO5S — CID 7878752
(2-methoxyphenyl)methyl 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 7878752) has the molecular formula C17H18ClNO5S and a molecular weight of 383.85 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | (2-methoxyphenyl)methyl 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7878752 |
| Molecular Formula | C17H18ClNO5S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (2-methoxyphenyl)methyl 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | COc1ccccc1COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C17H18ClNO5S/c1-19(2)25(21,22)13-8-9-15(18)14(10-13)17(20)24-11-12-6-4-5-7-16(12)23-3/h4-10H,11H2,1-3H3 |
| InChIKey | WDMFUVKCKLGMDN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |