(2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate

C17H19NO4S — CID 7844428

IUPAC(2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate
SMILESCc1ccccc1COC(=O)c1ccc(S(=O)(=O)N(C)C)cc1
InChIInChI=1S/C17H19NO4S/c1-13-6-4-5-7-15(13)12-22-17(19)14-8-10-16(11-9-14)23(20,21)18(2)3/h4-11H,12H2,1-3H3
InChIKeyDKCCYDHVZFBCIG-UHFFFAOYSA-N
MW333.41 g/mol
LogP2.60
Rot. Bonds5

About (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate

(2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate (PubChem CID 7844428) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate.

Molecular Properties

Compound Name(2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate
PubChem CID7844428
Molecular FormulaC17H19NO4S
Molecular Weight333.41 g/mol
Exact Mass333.10
IUPAC Name(2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate
SMILESCc1ccccc1COC(=O)c1ccc(S(=O)(=O)N(C)C)cc1
InChIInChI=1S/C17H19NO4S/c1-13-6-4-5-7-15(13)12-22-17(19)14-8-10-16(11-9-14)23(20,21)18(2)3/h4-11H,12H2,1-3H3
InChIKeyDKCCYDHVZFBCIG-UHFFFAOYSA-N
XLogP2.60
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.41
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
The IUPAC name of (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate (CID 7844428) is (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate.
What is the SMILES notation for (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
The canonical SMILES for (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate is Cc1ccccc1COC(=O)c1ccc(S(=O)(=O)N(C)C)cc1.
What is the InChIKey of (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
The InChIKey is DKCCYDHVZFBCIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S/c1-13-6-4-5-7-15(13)12-22-17(19)14-8-10-16(11-9-14)23(20,21)18(2)3/h4-11H,12H2,1-3H3.
What are the key properties of (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
(2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate has a molecular weight of 333.41 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methyl 4-(dimethylsulfamoyl)benzoate is sourced from PubChem (CID 7844428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).