About (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate
(2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate (PubChem CID 2603742) has the molecular formula C18H21NO5S
and a molecular weight of 363.44 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate |
| PubChem CID | 2603742 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate |
| SMILES | CCOc1ccccc1COC(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-4-23-17-8-6-5-7-15(17)13-24-18(20)14-9-11-16(12-10-14)25(21,22)19(2)3/h5-12H,4,13H2,1-3H3 |
| InChIKey | VHHSBYBIEKOTEO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
The IUPAC name of (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate (CID 2603742) is (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate.
What is the SMILES notation for (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
The canonical SMILES for (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate is CCOc1ccccc1COC(=O)c1ccc(S(=O)(=O)N(C)C)cc1.
What is the InChIKey of (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
The InChIKey is VHHSBYBIEKOTEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO5S/c1-4-23-17-8-6-5-7-15(17)13-24-18(20)14-9-11-16(12-10-14)25(21,22)19(2)3/h5-12H,4,13H2,1-3H3.
What are the key properties of (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate?
(2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate has a molecular weight of 363.44 g/mol, XLogP of 2.69, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyphenyl)methyl 4-(dimethylsulfamoyl)benzoate is sourced from PubChem (CID 2603742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).