C19H21NO5S — CID 35586379
(2-ethoxyphenyl)methyl 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 35586379) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | (2-ethoxyphenyl)methyl 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 35586379 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (2-ethoxyphenyl)methyl 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CCOc1ccccc1COC(=O)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H21NO5S/c1-2-24-18-9-4-3-6-15(18)13-25-19(21)14-7-5-8-17(12-14)26(22,23)20-16-10-11-16/h3-9,12,16,20H,2,10-11,13H2,1H3 |
| InChIKey | RBZICJTVMXAWNX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |