C18H18ClNO5S — CID 55475628
2-(3-chlorophenoxy)ethyl 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 55475628) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55475628 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | O=C(OCCOc1cccc(Cl)c1)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C18H18ClNO5S/c19-14-4-2-5-16(12-14)24-9-10-25-18(21)13-3-1-6-17(11-13)26(22,23)20-15-7-8-15/h1-6,11-12,15,20H,7-10H2 |
| InChIKey | IUXBAMNNDJRIJT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|