C19H20ClNO5S — CID 8672225
2-(3-methylphenoxy)ethyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate (PubChem CID 8672225) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | 2-(3-methylphenoxy)ethyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8672225 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
| SMILES | Cc1cccc(OCCOC(=O)c2ccc(Cl)c(S(=O)(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C19H20ClNO5S/c1-13-3-2-4-16(11-13)25-9-10-26-19(22)14-5-8-17(20)18(12-14)27(23,24)21-15-6-7-15/h2-5,8,11-12,15,21H,6-7,9-10H2,1H3 |
| InChIKey | CNCZLJPCDUQVCH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|