C16H15ClFNO5S — CID 9331974
2-(4-fluorophenoxy)ethyl 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 9331974) has the molecular formula C16H15ClFNO5S and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9331974 |
| Molecular Formula | C16H15ClFNO5S |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C16H15ClFNO5S/c1-19-25(21,22)15-10-11(2-7-14(15)17)16(20)24-9-8-23-13-5-3-12(18)4-6-13/h2-7,10,19H,8-9H2,1H3 |
| InChIKey | BCYLQJZBRKPHFH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|