C17H18ClNO6S — CID 7974148
2-(4-chlorophenoxy)ethyl 4-methoxy-3-(methylsulfamoyl)benzoate (PubChem CID 7974148) has the molecular formula C17H18ClNO6S and a molecular weight of 399.85 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 4-methoxy-3-(methylsulfamoyl)benzoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 4-methoxy-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7974148 |
| Molecular Formula | C17H18ClNO6S |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 4-methoxy-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(Cl)cc2)ccc1OC |
| InChI | InChI=1S/C17H18ClNO6S/c1-19-26(21,22)16-11-12(3-8-15(16)23-2)17(20)25-10-9-24-14-6-4-13(18)5-7-14/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | TYJATLPXRSOWJT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|