C22H22N2O6S — CID 46535308
4-(1,3-dioxoisoindol-2-yl)butyl 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 46535308) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46535308 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | O=C(OCCCCN1C(=O)c2ccccc2C1=O)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C22H22N2O6S/c25-20-18-8-1-2-9-19(18)21(26)24(20)12-3-4-13-30-22(27)15-6-5-7-17(14-15)31(28,29)23-16-10-11-16/h1-2,5-9,14,16,23H,3-4,10-13H2 |
| InChIKey | FDILNGMQABLDDN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|