C18H19N3O6S — CID 55459390
3-(1,3-dioxoisoindol-2-yl)propyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate (PubChem CID 55459390) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55459390 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCCCN2C(=O)c3ccccc3C2=O)n(C)c1 |
| InChI | InChI=1S/C18H19N3O6S/c1-19-28(25,26)12-10-15(20(2)11-12)18(24)27-9-5-8-21-16(22)13-6-3-4-7-14(13)17(21)23/h3-4,6-7,10-11,19H,5,8-9H2,1-2H3 |
| InChIKey | ODOHJVQCEVOVDH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|