C26H23N3O7S — CID 22564795
3-(1,3-dioxoisoindol-2-yl)propyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate (PubChem CID 22564795) has the molecular formula C26H23N3O7S and a molecular weight of 521.55 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 22564795 |
| Molecular Formula | C26H23N3O7S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(C(=O)OCCCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O7S/c1-17-7-13-20(14-8-17)37(34,35)28-26(33)27-19-11-9-18(10-12-19)25(32)36-16-4-15-29-23(30)21-5-2-3-6-22(21)24(29)31/h2-3,5-14H,4,15-16H2,1H3,(H2,27,28,33) |
| InChIKey | XMIYSWUSRBRRCI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|