C27H25N3O5 — CID 20759768
3-(1,3-dioxoisoindol-2-yl)propyl 3-[(4-methylphenyl)methylcarbamoylamino]benzoate (PubChem CID 20759768) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 3-[(4-methylphenyl)methylcarbamoylamino]benzoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-[(4-methylphenyl)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 20759768 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-[(4-methylphenyl)methylcarbamoylamino]benzoate |
| SMILES | Cc1ccc(CNC(=O)Nc2cccc(C(=O)OCCCN3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C27H25N3O5/c1-18-10-12-19(13-11-18)17-28-27(34)29-21-7-4-6-20(16-21)26(33)35-15-5-14-30-24(31)22-8-2-3-9-23(22)25(30)32/h2-4,6-13,16H,5,14-15,17H2,1H3,(H2,28,29,34) |
| InChIKey | BPJKATHJRWGVKS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|