C18H15NO5S — CID 32561901
3-(1,3-dioxoisoindol-2-yl)propyl 5-acetylthiophene-2-carboxylate (PubChem CID 32561901) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 5-acetylthiophene-2-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 5-acetylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 32561901 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 5-acetylthiophene-2-carboxylate |
| SMILES | CC(=O)c1ccc(C(=O)OCCCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C18H15NO5S/c1-11(20)14-7-8-15(25-14)18(23)24-10-4-9-19-16(21)12-5-2-3-6-13(12)17(19)22/h2-3,5-8H,4,9-10H2,1H3 |
| InChIKey | USKODKUZWSEWHP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|