C19H19NO5 — CID 16531504
4-(1,3-dioxoisoindol-2-yl)butyl 2,5-dimethylfuran-3-carboxylate (PubChem CID 16531504) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 2,5-dimethylfuran-3-carboxylate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 16531504 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCCCCN2C(=O)c3ccccc3C2=O)c(C)o1 |
| InChI | InChI=1S/C19H19NO5/c1-12-11-16(13(2)25-12)19(23)24-10-6-5-9-20-17(21)14-7-3-4-8-15(14)18(20)22/h3-4,7-8,11H,5-6,9-10H2,1-2H3 |
| InChIKey | MYVLUOTYYPKYCU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|