C18H15NO6 — CID 33271142
2-(1,3-dioxoisoindol-2-yl)ethyl 2,4-dimethyl-6-oxopyran-3-carboxylate (PubChem CID 33271142) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2,4-dimethyl-6-oxopyran-3-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2,4-dimethyl-6-oxopyran-3-carboxylate |
|---|---|
| PubChem CID | 33271142 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2,4-dimethyl-6-oxopyran-3-carboxylate |
| SMILES | Cc1cc(=O)oc(C)c1C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H15NO6/c1-10-9-14(20)25-11(2)15(10)18(23)24-8-7-19-16(21)12-5-3-4-6-13(12)17(19)22/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | QIOWTUBMLGJZLS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|