C21H15NO6 — CID 27706048
2-(1,3-dioxoisoindol-2-yl)ethyl 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 27706048) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 27706048 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)OCCN3C(=O)c4ccccc4C3=O)cc(=O)c2c1 |
| InChI | InChI=1S/C21H15NO6/c1-12-6-7-17-15(10-12)16(23)11-18(28-17)21(26)27-9-8-22-19(24)13-4-2-3-5-14(13)20(22)25/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | VWHDRBKIYZSXPM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|