C19H17NO7S — CID 7614760
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 4-oxochromene-2-carboxylate (PubChem CID 7614760) has the molecular formula C19H17NO7S and a molecular weight of 403.41 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 4-oxochromene-2-carboxylate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 7614760 |
| Molecular Formula | C19H17NO7S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCOC(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H17NO7S/c1-2-25-18(23)10-17-20(16(22)11-28-17)7-8-26-19(24)15-9-13(21)12-5-3-4-6-14(12)27-15/h3-6,9-10H,2,7-8,11H2,1H3/b17-10- |
| InChIKey | JGLJKRZDIZQRAM-YVLHZVERSA-N |
| XLogP | 1.93 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|