C21H20O5 — CID 8728614
2-(3,5-dimethylphenoxy)ethyl 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8728614) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)ethyl 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | 2-(3,5-dimethylphenoxy)ethyl 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8728614 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)ethyl 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1cc(C)cc(OCCOC(=O)c2cc(=O)c3cc(C)ccc3o2)c1 |
| InChI | InChI=1S/C21H20O5/c1-13-4-5-19-17(11-13)18(22)12-20(26-19)21(23)25-7-6-24-16-9-14(2)8-15(3)10-16/h4-5,8-12H,6-7H2,1-3H3 |
| InChIKey | COAODBSJYLUDQX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|