C16H16N2O6 — CID 8729510
[2-(ethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8729510) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8729510 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1cc(=O)c2cc(C)ccc2o1 |
| InChI | InChI=1S/C16H16N2O6/c1-3-17-16(22)18-14(20)8-23-15(21)13-7-11(19)10-6-9(2)4-5-12(10)24-13/h4-7H,3,8H2,1-2H3,(H2,17,18,20,22) |
| InChIKey | UKUGFLZPODCTLO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |