C19H13ClFNO5 — CID 8728915
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8728915) has the molecular formula C19H13ClFNO5 and a molecular weight of 389.77 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8728915 |
| Molecular Formula | C19H13ClFNO5 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)OCC(=O)Nc3ccc(Cl)cc3F)cc(=O)c2c1 |
| InChI | InChI=1S/C19H13ClFNO5/c1-10-2-5-16-12(6-10)15(23)8-17(27-16)19(25)26-9-18(24)22-14-4-3-11(20)7-13(14)21/h2-8H,9H2,1H3,(H,22,24) |
| InChIKey | CUKVWGHTBARMPB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |