C17H18ClNO5 — CID 8876830
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 6-chloro-4-oxochromene-2-carboxylate (PubChem CID 8876830) has the molecular formula C17H18ClNO5 and a molecular weight of 351.79 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 6-chloro-4-oxochromene-2-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 6-chloro-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8876830 |
| Molecular Formula | C17H18ClNO5 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 6-chloro-4-oxochromene-2-carboxylate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H18ClNO5/c1-3-4-10(2)19-16(21)9-23-17(22)15-8-13(20)12-7-11(18)5-6-14(12)24-15/h5-8,10H,3-4,9H2,1-2H3,(H,19,21)/t10-/m1/s1 |
| InChIKey | UYUMVDNZLAXCLI-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |