(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate

C19H15ClO5 — CID 8877344

IUPAC(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate
SMILESCCOc1ccccc1COC(=O)c1cc(=O)c2cc(Cl)ccc2o1
InChIInChI=1S/C19H15ClO5/c1-2-23-16-6-4-3-5-12(16)11-24-19(22)18-10-15(21)14-9-13(20)7-8-17(14)25-18/h3-10H,2,11H2,1H3
InChIKeyOWNVLIPTLBASFE-UHFFFAOYSA-N
MW358.78 g/mol
LogP4.20
Rot. Bonds5

About (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate

(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate (PubChem CID 8877344) has the molecular formula C19H15ClO5 and a molecular weight of 358.78 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate.

Molecular Properties

Compound Name(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate
PubChem CID8877344
Molecular FormulaC19H15ClO5
Molecular Weight358.78 g/mol
Exact Mass358.06
IUPAC Name(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate
SMILESCCOc1ccccc1COC(=O)c1cc(=O)c2cc(Cl)ccc2o1
InChIInChI=1S/C19H15ClO5/c1-2-23-16-6-4-3-5-12(16)11-24-19(22)18-10-15(21)14-9-13(20)7-8-17(14)25-18/h3-10H,2,11H2,1H3
InChIKeyOWNVLIPTLBASFE-UHFFFAOYSA-N
XLogP4.20
TPSA65.74 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.78
LogP ≤ 54.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate?
The IUPAC name of (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate (CID 8877344) is (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate.
What is the SMILES notation for (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate?
The canonical SMILES for (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate is CCOc1ccccc1COC(=O)c1cc(=O)c2cc(Cl)ccc2o1.
What is the InChIKey of (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate?
The InChIKey is OWNVLIPTLBASFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClO5/c1-2-23-16-6-4-3-5-12(16)11-24-19(22)18-10-15(21)14-9-13(20)7-8-17(14)25-18/h3-10H,2,11H2,1H3.
What are the key properties of (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate?
(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate has a molecular weight of 358.78 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate is sourced from PubChem (CID 8877344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).