C19H15ClO5 — CID 8877344
(2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate (PubChem CID 8877344) has the molecular formula C19H15ClO5 and a molecular weight of 358.78 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate.
| Compound Name | (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8877344 |
| Molecular Formula | C19H15ClO5 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (2-ethoxyphenyl)methyl 6-chloro-4-oxochromene-2-carboxylate |
| SMILES | CCOc1ccccc1COC(=O)c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C19H15ClO5/c1-2-23-16-6-4-3-5-12(16)11-24-19(22)18-10-15(21)14-9-13(20)7-8-17(14)25-18/h3-10H,2,11H2,1H3 |
| InChIKey | OWNVLIPTLBASFE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |