C20H14N2O5 — CID 8728970
[2-(4-cyanoanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8728970) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8728970 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)OCC(=O)Nc3ccc(C#N)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C20H14N2O5/c1-12-2-7-17-15(8-12)16(23)9-18(27-17)20(25)26-11-19(24)22-14-5-3-13(10-21)4-6-14/h2-9H,11H2,1H3,(H,22,24) |
| InChIKey | BSEHINXAHAPNRE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |