C17H16N2O5 — CID 8729284
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8729284) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8729284 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)OCC(=O)N(C)CCC#N)cc(=O)c2c1 |
| InChI | InChI=1S/C17H16N2O5/c1-11-4-5-14-12(8-11)13(20)9-15(24-14)17(22)23-10-16(21)19(2)7-3-6-18/h4-5,8-9H,3,7,10H2,1-2H3 |
| InChIKey | OTGXUDWEHMNEPY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |