C23H22O5 — CID 8729103
[2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8729103) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8729103 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | CC[C@H](C)c1ccc(C(=O)COC(=O)c2cc(=O)c3cc(C)ccc3o2)cc1 |
| InChI | InChI=1S/C23H22O5/c1-4-15(3)16-6-8-17(9-7-16)20(25)13-27-23(26)22-12-19(24)18-11-14(2)5-10-21(18)28-22/h5-12,15H,4,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | GHHPZQDSVNDXGG-HNNXBMFYSA-N |
| XLogP | 4.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |