C19H16N2O6S — CID 9381012
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 9381012) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 9381012 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)OCC(=O)NC(=O)NCc3cccs3)cc(=O)c2c1 |
| InChI | InChI=1S/C19H16N2O6S/c1-11-4-5-15-13(7-11)14(22)8-16(27-15)18(24)26-10-17(23)21-19(25)20-9-12-3-2-6-28-12/h2-8H,9-10H2,1H3,(H2,20,21,23,25) |
| InChIKey | LGUZIOOFSSGPTQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |