C16H18N2O4 — CID 70417660
4-(1,3-dioxoisoindol-2-yl)butyl 3-aminobut-2-enoate (PubChem CID 70417660) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 3-aminobut-2-enoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-aminobut-2-enoate |
|---|---|
| PubChem CID | 70417660 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-aminobut-2-enoate |
| SMILES | CC(N)=CC(=O)OCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O4/c1-11(17)10-14(19)22-9-5-4-8-18-15(20)12-6-2-3-7-13(12)16(18)21/h2-3,6-7,10H,4-5,8-9,17H2,1H3 |
| InChIKey | IJWPIPGDTJAEPV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|