C15H16N2O4 — CID 70592111
propyl 3-amino-4-(1,3-dioxoisoindol-2-yl)but-2-enoate (PubChem CID 70592111) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is propyl 3-amino-4-(1,3-dioxoisoindol-2-yl)but-2-enoate.
| Compound Name | propyl 3-amino-4-(1,3-dioxoisoindol-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 70592111 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | propyl 3-amino-4-(1,3-dioxoisoindol-2-yl)but-2-enoate |
| SMILES | CCCOC(=O)C=C(N)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H16N2O4/c1-2-7-21-13(18)8-10(16)9-17-14(19)11-5-3-4-6-12(11)15(17)20/h3-6,8H,2,7,9,16H2,1H3 |
| InChIKey | DHSXANPVBXDELN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|