C24H19NO5S — CID 46811990
4-(1,3-dioxoisoindol-2-yl)butyl 2-(thiophene-2-carbonyl)benzoate (PubChem CID 46811990) has the molecular formula C24H19NO5S and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 46811990 |
| Molecular Formula | C24H19NO5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-(thiophene-2-carbonyl)benzoate |
| SMILES | O=C(OCCCCN1C(=O)c2ccccc2C1=O)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C24H19NO5S/c26-21(20-12-7-15-31-20)16-8-1-4-11-19(16)24(29)30-14-6-5-13-25-22(27)17-9-2-3-10-18(17)23(25)28/h1-4,7-12,15H,5-6,13-14H2 |
| InChIKey | IRHJXCBBYHGDCT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|