C22H15NO5S — CID 68818531
1-(1,3-dioxoisoindol-2-yl)ethyl 2-(thiophene-2-carbonyl)benzoate (PubChem CID 68818531) has the molecular formula C22H15NO5S and a molecular weight of 405.43 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-2-yl)ethyl 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | 1-(1,3-dioxoisoindol-2-yl)ethyl 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 68818531 |
| Molecular Formula | C22H15NO5S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 1-(1,3-dioxoisoindol-2-yl)ethyl 2-(thiophene-2-carbonyl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1C(=O)c1cccs1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H15NO5S/c1-13(23-20(25)15-8-3-4-9-16(15)21(23)26)28-22(27)17-10-5-2-7-14(17)19(24)18-11-6-12-29-18/h2-13H,1H3 |
| InChIKey | XTUOFKZICVGGEA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|