C14H9NO3S — CID 7960051
2-(2-oxo-2-thiophen-2-ylethyl)isoindole-1,3-dione (PubChem CID 7960051) has the molecular formula C14H9NO3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-(2-oxo-2-thiophen-2-ylethyl)isoindole-1,3-dione.
| Compound Name | 2-(2-oxo-2-thiophen-2-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 7960051 |
| Molecular Formula | C14H9NO3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-(2-oxo-2-thiophen-2-ylethyl)isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1cccs1 |
| InChI | InChI=1S/C14H9NO3S/c16-11(12-6-3-7-19-12)8-15-13(17)9-4-1-2-5-10(9)14(15)18/h1-7H,8H2 |
| InChIKey | NEKKQTRELFAINI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|