C15H9FN2O3 — CID 53403480
2-[2-(2-fluoro-3-pyridinyl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 53403480) has the molecular formula C15H9FN2O3 and a molecular weight of 284.25 g/mol. Its IUPAC name is 2-[2-(2-fluoro-3-pyridinyl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-fluoro-3-pyridinyl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53403480 |
| Molecular Formula | C15H9FN2O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[2-(2-fluoro-3-pyridinyl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1cccnc1F |
| InChI | InChI=1S/C15H9FN2O3/c16-13-11(6-3-7-17-13)12(19)8-18-14(20)9-4-1-2-5-10(9)15(18)21/h1-7H,8H2 |
| InChIKey | WXOHVFCLWFJVGO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|