C16H10FNO5 — CID 10403400
2-[2-(2-fluoro-4,5-dihydroxyphenyl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 10403400) has the molecular formula C16H10FNO5 and a molecular weight of 315.26 g/mol. Its IUPAC name is 2-[2-(2-fluoro-4,5-dihydroxyphenyl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-fluoro-4,5-dihydroxyphenyl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10403400 |
| Molecular Formula | C16H10FNO5 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[2-(2-fluoro-4,5-dihydroxyphenyl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1cc(O)c(O)cc1F |
| InChI | InChI=1S/C16H10FNO5/c17-11-6-13(20)12(19)5-10(11)14(21)7-18-15(22)8-3-1-2-4-9(8)16(18)23/h1-6,19-20H,7H2 |
| InChIKey | IPHMODBWOSSMCE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|