C17H12FNO4 — CID 70428800
2-[(E)-2-(3,4-dihydroxyphenyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione (PubChem CID 70428800) has the molecular formula C17H12FNO4 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dihydroxyphenyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-2-(3,4-dihydroxyphenyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70428800 |
| Molecular Formula | C17H12FNO4 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[(E)-2-(3,4-dihydroxyphenyl)-3-fluoroprop-2-enyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C/C(=C/F)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H12FNO4/c18-8-11(10-5-6-14(20)15(21)7-10)9-19-16(22)12-3-1-2-4-13(12)17(19)23/h1-8,20-21H,9H2/b11-8- |
| InChIKey | KHWGUFUEPRCWDJ-FLIBITNWSA-N |
| XLogP | 2.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|