C18H14N2O6 — CID 108764244
2-[3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-hydroxyphenyl]acetic acid (PubChem CID 108764244) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 108764244 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-hydroxyphenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(O)c(NC(=O)CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H14N2O6/c21-14-6-5-10(8-16(23)24)7-13(14)19-15(22)9-20-17(25)11-3-1-2-4-12(11)18(20)26/h1-7,21H,8-9H2,(H,19,22)(H,23,24) |
| InChIKey | VSMBKKZPNUFXEN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|