C22H16N2O3 — CID 23247841
2-[2-(3-benzoyl-2-pyridinyl)ethyl]isoindole-1,3-dione (PubChem CID 23247841) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[2-(3-benzoyl-2-pyridinyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-benzoyl-2-pyridinyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23247841 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[2-(3-benzoyl-2-pyridinyl)ethyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1)c1cccnc1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H16N2O3/c25-20(15-7-2-1-3-8-15)18-11-6-13-23-19(18)12-14-24-21(26)16-9-4-5-10-17(16)22(24)27/h1-11,13H,12,14H2 |
| InChIKey | OXHQFBPPJFLOTO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|