C15H10FNO3S — CID 62023101
7-fluoro-5-methyl-1-(2-oxo-2-thiophen-2-ylethyl)indole-2,3-dione (PubChem CID 62023101) has the molecular formula C15H10FNO3S and a molecular weight of 303.31 g/mol. Its IUPAC name is 7-fluoro-5-methyl-1-(2-oxo-2-thiophen-2-ylethyl)indole-2,3-dione.
| Compound Name | 7-fluoro-5-methyl-1-(2-oxo-2-thiophen-2-ylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 62023101 |
| Molecular Formula | C15H10FNO3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 7-fluoro-5-methyl-1-(2-oxo-2-thiophen-2-ylethyl)indole-2,3-dione |
| SMILES | Cc1cc(F)c2c(c1)C(=O)C(=O)N2CC(=O)c1cccs1 |
| InChI | InChI=1S/C15H10FNO3S/c1-8-5-9-13(10(16)6-8)17(15(20)14(9)19)7-11(18)12-3-2-4-21-12/h2-6H,7H2,1H3 |
| InChIKey | ORPYKBJASNBRJD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|