C23H19NO4S — CID 8835492
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonyl)benzoate (PubChem CID 8835492) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 8835492 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonyl)benzoate |
| SMILES | O=C(O[C@@H](C(=O)NC1CC1)c1ccccc1)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C23H19NO4S/c25-20(19-11-6-14-29-19)17-9-4-5-10-18(17)23(27)28-21(15-7-2-1-3-8-15)22(26)24-16-12-13-16/h1-11,14,16,21H,12-13H2,(H,24,26)/t21-/m1/s1 |
| InChIKey | ZHNMPCYDXXMASK-OAQYLSRUSA-N |
| XLogP | 4.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |