C19H19NO4S — CID 11927503
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11927503) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927503 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | C[S@](=O)c1ccccc1C(=O)O[C@@H](C(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4S/c1-25(23)16-10-6-5-9-15(16)19(22)24-17(13-7-3-2-4-8-13)18(21)20-14-11-12-14/h2-10,14,17H,11-12H2,1H3,(H,20,21)/t17-,25+/m1/s1 |
| InChIKey | LZPMPVMGIZSWDF-NSYGIPOTSA-N |
| XLogP | 2.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |