C21H20N2O3 — CID 46827409
[2-(cyclopropylamino)-2-oxo-1-phenylethyl] 1-methylindole-3-carboxylate (PubChem CID 46827409) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 1-methylindole-3-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 46827409 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 1-methylindole-3-carboxylate |
| SMILES | Cn1cc(C(=O)OC(C(=O)NC2CC2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H20N2O3/c1-23-13-17(16-9-5-6-10-18(16)23)21(25)26-19(14-7-3-2-4-8-14)20(24)22-15-11-12-15/h2-10,13,15,19H,11-12H2,1H3,(H,22,24) |
| InChIKey | RWJOOXZIPKEFRQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |