C18H18N2O5S — CID 11927180
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[(R)-methylsulfinyl]benzoate (PubChem CID 11927180) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[(R)-methylsulfinyl]benzoate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[(R)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927180 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[(R)-methylsulfinyl]benzoate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)c1ccccc1[S@@](C)=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-19-18(23)20-16(21)15(12-8-4-3-5-9-12)25-17(22)13-10-6-7-11-14(13)26(2)24/h3-11,15H,1-2H3,(H2,19,20,21,23)/t15-,26-/m1/s1 |
| InChIKey | FEJGKLOGMJMUQR-PVPMGCCUSA-N |
| XLogP | 1.78 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |