C18H18ClN3O5 — CID 7832619
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 7832619) has the molecular formula C18H18ClN3O5 and a molecular weight of 391.81 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 7832619 |
| Molecular Formula | C18H18ClN3O5 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)c1cc(Cl)c(N)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C18H18ClN3O5/c1-21-18(25)22-16(23)15(10-6-4-3-5-7-10)27-17(24)11-8-12(19)13(20)9-14(11)26-2/h3-9,15H,20H2,1-2H3,(H2,21,22,23,25)/t15-/m0/s1 |
| InChIKey | RGFXTVWGQVPXIV-HNNXBMFYSA-N |
| XLogP | 2.28 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|