C19H15ClN2O5 — CID 46627394
[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-1-benzofuran-2-carboxylate (PubChem CID 46627394) has the molecular formula C19H15ClN2O5 and a molecular weight of 386.79 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 46627394 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 5-chloro-1-benzofuran-2-carboxylate |
| SMILES | CNC(=O)NC(=O)C(OC(=O)c1cc2cc(Cl)ccc2o1)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O5/c1-21-19(25)22-17(23)16(11-5-3-2-4-6-11)27-18(24)15-10-12-9-13(20)7-8-14(12)26-15/h2-10,16H,1H3,(H2,21,22,23,25) |
| InChIKey | ULTMLQINHHIOHX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |