C19H16O3S2 — CID 11960620
3-thiophen-2-ylpropyl 2-(thiophene-2-carbonyl)benzoate (PubChem CID 11960620) has the molecular formula C19H16O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-thiophen-2-ylpropyl 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | 3-thiophen-2-ylpropyl 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 11960620 |
| Molecular Formula | C19H16O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3-thiophen-2-ylpropyl 2-(thiophene-2-carbonyl)benzoate |
| SMILES | O=C(OCCCc1cccs1)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C19H16O3S2/c20-18(17-10-5-13-24-17)15-8-1-2-9-16(15)19(21)22-11-3-6-14-7-4-12-23-14/h1-2,4-5,7-10,12-13H,3,6,11H2 |
| InChIKey | YHVGEZZSIFNWRT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|