About 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate
2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate (PubChem CID 80712277) has the molecular formula C14H13FO2S
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate |
| PubChem CID | 80712277 |
| Molecular Formula | C14H13FO2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCCc2cccs2)c1F |
| InChI | InChI=1S/C14H13FO2S/c1-10-4-2-6-12(13(10)15)14(16)17-8-7-11-5-3-9-18-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | OMCFJOLWZOEGHD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate?
The IUPAC name of 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate (CID 80712277) is 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate.
What is the SMILES notation for 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate?
The canonical SMILES for 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate is Cc1cccc(C(=O)OCCc2cccs2)c1F.
What is the InChIKey of 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate?
The InChIKey is OMCFJOLWZOEGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FO2S/c1-10-4-2-6-12(13(10)15)14(16)17-8-7-11-5-3-9-18-11/h2-6,9H,7-8H2,1H3.
What are the key properties of 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate?
2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate has a molecular weight of 264.32 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl 2-fluoro-3-methylbenzoate is sourced from PubChem (CID 80712277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).