C15H16OS — CID 114973203
1-(2,3-dimethylphenyl)-3-thiophen-2-ylpropan-1-one (PubChem CID 114973203) has the molecular formula C15H16OS and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-(2,3-dimethylphenyl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 114973203 |
| Molecular Formula | C15H16OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-thiophen-2-ylpropan-1-one |
| SMILES | Cc1cccc(C(=O)CCc2cccs2)c1C |
| InChI | InChI=1S/C15H16OS/c1-11-5-3-7-14(12(11)2)15(16)9-8-13-6-4-10-17-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | SUMGZYXRBCZJAE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |