About 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate
2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate (PubChem CID 106777636) has the molecular formula C16H12ClNO2S
and a molecular weight of 317.80 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate |
| PubChem CID | 106777636 |
| Molecular Formula | C16H12ClNO2S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate |
| SMILES | O=C(OCCc1cccs1)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C16H12ClNO2S/c17-15-13-6-2-1-5-12(13)14(10-18-15)16(19)20-8-7-11-4-3-9-21-11/h1-6,9-10H,7-8H2 |
| InChIKey | SLYIRFHHLPNWTK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate?
The IUPAC name of 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate (CID 106777636) is 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate.
What is the SMILES notation for 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate?
The canonical SMILES for 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate is O=C(OCCc1cccs1)c1cnc(Cl)c2ccccc12.
What is the InChIKey of 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate?
The InChIKey is SLYIRFHHLPNWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO2S/c17-15-13-6-2-1-5-12(13)14(10-18-15)16(19)20-8-7-11-4-3-9-21-11/h1-6,9-10H,7-8H2.
What are the key properties of 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate?
2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate has a molecular weight of 317.80 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl 1-chloroisoquinoline-4-carboxylate is sourced from PubChem (CID 106777636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).