2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate

C11H9ClN2O2S — CID 106547524

IUPAC2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate
SMILESO=C(OCCc1cccs1)c1cncc(Cl)n1
InChIInChI=1S/C11H9ClN2O2S/c12-10-7-13-6-9(14-10)11(15)16-4-3-8-2-1-5-17-8/h1-2,5-7H,3-4H2
InChIKeyPILIXWLVSINWRE-UHFFFAOYSA-N
MW268.72 g/mol
LogP2.59
Rot. Bonds4

About 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate

2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate (PubChem CID 106547524) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate.

Molecular Properties

Compound Name2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate
PubChem CID106547524
Molecular FormulaC11H9ClN2O2S
Molecular Weight268.72 g/mol
Exact Mass268.01
IUPAC Name2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate
SMILESO=C(OCCc1cccs1)c1cncc(Cl)n1
InChIInChI=1S/C11H9ClN2O2S/c12-10-7-13-6-9(14-10)11(15)16-4-3-8-2-1-5-17-8/h1-2,5-7H,3-4H2
InChIKeyPILIXWLVSINWRE-UHFFFAOYSA-N
XLogP2.59
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.72
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate?
The IUPAC name of 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate (CID 106547524) is 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate.
What is the SMILES notation for 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate?
The canonical SMILES for 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate is O=C(OCCc1cccs1)c1cncc(Cl)n1.
What is the InChIKey of 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate?
The InChIKey is PILIXWLVSINWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O2S/c12-10-7-13-6-9(14-10)11(15)16-4-3-8-2-1-5-17-8/h1-2,5-7H,3-4H2.
What are the key properties of 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate?
2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate has a molecular weight of 268.72 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl 6-chloropyrazine-2-carboxylate is sourced from PubChem (CID 106547524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).